(S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline (2S,3S)-2,3-dihydroxybutanedioate - Names and Identifiers
Name | (S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline D-(-)-tartrate
|
Synonyms | (S)-1,2,3,4-tetrahyd SZEOPQAHUUEDMC-XQIJAYBJSA-N Isoquinoline,1,2,3,4-tetrahydro-1-phenyl-(1s), (S)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline tartrate (S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline D-(-)-tartrate (S)-1,2,3,4-tetrahydro-1-phenylisoquinoline D-(-)-tartrate (S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline (2S,3S)-2,3-dihydroxysuccinate (S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline (2S,3S)-2,3-dihydroxybutanedioate
|
CAS | 869884-00-4
|
InChI | InChI=1/C15H15N.C4H6O6/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;5-1(3(7)8)2(6)4(9)10/h1-9,15-16H,10-11H2;1-2,5-6H,(H,7,8)(H,9,10)/t15-;1-,2-/m00/s1 |
(S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline (2S,3S)-2,3-dihydroxybutanedioate - Physico-chemical Properties
Molecular Formula | C15H15N.C4H6O6
|
Molar Mass | 359.37 |
Boling Point | 338.4°C at 760 mmHg |
Flash Point | 166.9°C |
Vapor Presure | 9.87E-05mmHg at 25°C |
(S)-1,2,3,4-Tetrahydro-1-phenylisoquinoline (2S,3S)-2,3-dihydroxybutanedioate - Introduction
(S)-1,2,3, D-(-)-tartrate is an organic compound with the chemical formula C19H23NO C4H6O6.
Properties of the compound include:
1. Appearance: white crystalline powder
2. Solubility: Soluble in water, methanol and ethanol
3. optical rotation: optical rotation
Its main uses are:
1. As a drug intermediate: It can be used to synthesize a variety of drugs, such as antiepileptic drugs, antidepressants, etc.
2. As a chiral reagent: Because it has chiral properties, it can be used to synthesize chiral compounds.
The preparation method usually includes the following steps:
1. react (S)-1,2,3,4-tetrahydro-1-phenylisoquinoline with D-(-)-tartaric acid to generate (S)-1,2,3, D-(-)-tartrate.
Safety Information:
The compound has not been fully evaluated for its effects on humans and the environment. When handling and using, you need to pay attention to the following safety measures:
1. avoid contact with skin and eyes, if accidentally contact, immediately rinse with plenty of water.
2. Use in a well-ventilated place to avoid inhaling the dust or gas of the substance.
3. Store it in a sealed container, away from moisture and fire.
4. Use personal protective equipment, such as gloves and glasses.
In general, when handling and using (S)-1,2,3, D-(-)-tartrate, you should follow the correct operating procedures and take appropriate safety measures.
Last Update:2024-04-09 21:04:16